C19H21N3O5S — CID 55534420
methyl 2-(4-benzoylpiperazin-1-yl)-5-sulfamoylbenzoate (PubChem CID 55534420) has the molecular formula C19H21N3O5S and a molecular weight of 403.46 g/mol. Its IUPAC name is methyl 2-(4-benzoylpiperazin-1-yl)-5-sulfamoylbenzoate.
| Compound Name | methyl 2-(4-benzoylpiperazin-1-yl)-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55534420 |
| Molecular Formula | C19H21N3O5S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | methyl 2-(4-benzoylpiperazin-1-yl)-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1N1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21N3O5S/c1-27-19(24)16-13-15(28(20,25)26)7-8-17(16)21-9-11-22(12-10-21)18(23)14-5-3-2-4-6-14/h2-8,13H,9-12H2,1H3,(H2,20,25,26) |
| InChIKey | GGPABEINTVNYLY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |