C17H24N4O5S — CID 55533626
methyl 2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-5-sulfamoylbenzoate (PubChem CID 55533626) has the molecular formula C17H24N4O5S and a molecular weight of 396.47 g/mol. Its IUPAC name is methyl 2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-5-sulfamoylbenzoate.
| Compound Name | methyl 2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55533626 |
| Molecular Formula | C17H24N4O5S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl 2-[4-[2-(cyclopropylamino)-2-oxoethyl]piperazin-1-yl]-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1N1CCN(CC(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C17H24N4O5S/c1-26-17(23)14-10-13(27(18,24)25)4-5-15(14)21-8-6-20(7-9-21)11-16(22)19-12-2-3-12/h4-5,10,12H,2-3,6-9,11H2,1H3,(H,19,22)(H2,18,24,25) |
| InChIKey | RRRCYSUDXSEMMQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |