C21H24N4O4S — CID 55534363
methyl 2-[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]-5-sulfamoylbenzoate (PubChem CID 55534363) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is methyl 2-[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]-5-sulfamoylbenzoate.
| Compound Name | methyl 2-[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55534363 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | methyl 2-[4-[(4-cyanophenyl)methyl]-1,4-diazepan-1-yl]-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1N1CCCN(Cc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C21H24N4O4S/c1-29-21(26)19-13-18(30(23,27)28)7-8-20(19)25-10-2-9-24(11-12-25)15-17-5-3-16(14-22)4-6-17/h3-8,13H,2,9-12,15H2,1H3,(H2,23,27,28) |
| InChIKey | JLBABLXPKWXPEA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |