C21H25N3O7S — CID 55544412
methyl 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-5-sulfamoylbenzoate (PubChem CID 55544412) has the molecular formula C21H25N3O7S and a molecular weight of 463.51 g/mol. Its IUPAC name is methyl 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-5-sulfamoylbenzoate.
| Compound Name | methyl 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55544412 |
| Molecular Formula | C21H25N3O7S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | methyl 2-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]-5-sulfamoylbenzoate |
| SMILES | COC(=O)c1cc(S(N)(=O)=O)ccc1N1CCN(C(=O)c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C21H25N3O7S/c1-29-18-7-4-14(12-19(18)30-2)20(25)24-10-8-23(9-11-24)17-6-5-15(32(22,27)28)13-16(17)21(26)31-3/h4-7,12-13H,8-11H2,1-3H3,(H2,22,27,28) |
| InChIKey | HCEUIISUCRUWOS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |