methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate

C21H24N2O5 — CID 113078463

IUPACmethyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate
SMILESCOC(=O)c1cccc(N2CCN(C(=O)c3ccc(OC)c(OC)c3)CC2)c1
InChIInChI=1S/C21H24N2O5/c1-26-18-8-7-15(14-19(18)27-2)20(24)23-11-9-22(10-12-23)17-6-4-5-16(13-17)21(25)28-3/h4-8,13-14H,9-12H2,1-3H3
InChIKeyAOCNRYPIMYIOEJ-UHFFFAOYSA-N
MW384.43 g/mol
LogP2.45
Rot. Bonds5

About methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate

methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate (PubChem CID 113078463) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate.

Molecular Properties

Compound Namemethyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate
PubChem CID113078463
Molecular FormulaC21H24N2O5
Molecular Weight384.43 g/mol
Exact Mass384.17
IUPAC Namemethyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate
SMILESCOC(=O)c1cccc(N2CCN(C(=O)c3ccc(OC)c(OC)c3)CC2)c1
InChIInChI=1S/C21H24N2O5/c1-26-18-8-7-15(14-19(18)27-2)20(24)23-11-9-22(10-12-23)17-6-4-5-16(13-17)21(25)28-3/h4-8,13-14H,9-12H2,1-3H3
InChIKeyAOCNRYPIMYIOEJ-UHFFFAOYSA-N
XLogP2.45
TPSA68.31 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500384.43
LogP ≤ 52.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate?
The IUPAC name of methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate (CID 113078463) is methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate.
What is the SMILES notation for methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate?
The canonical SMILES for methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate is COC(=O)c1cccc(N2CCN(C(=O)c3ccc(OC)c(OC)c3)CC2)c1.
What is the InChIKey of methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate?
The InChIKey is AOCNRYPIMYIOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O5/c1-26-18-8-7-15(14-19(18)27-2)20(24)23-11-9-22(10-12-23)17-6-4-5-16(13-17)21(25)28-3/h4-8,13-14H,9-12H2,1-3H3.
What are the key properties of methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate?
methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate has a molecular weight of 384.43 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoate is sourced from PubChem (CID 113078463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).