C20H23N3O4 — CID 113113513
methyl 3-[4-[(2-methoxyphenyl)carbamoyl]piperazin-1-yl]benzoate (PubChem CID 113113513) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl 3-[4-[(2-methoxyphenyl)carbamoyl]piperazin-1-yl]benzoate.
| Compound Name | methyl 3-[4-[(2-methoxyphenyl)carbamoyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 113113513 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | methyl 3-[4-[(2-methoxyphenyl)carbamoyl]piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2CCN(C(=O)Nc3ccccc3OC)CC2)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-26-18-9-4-3-8-17(18)21-20(25)23-12-10-22(11-13-23)16-7-5-6-15(14-16)19(24)27-2/h3-9,14H,10-13H2,1-2H3,(H,21,25) |
| InChIKey | JMGXQHLJFLAAHO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |