C18H19Cl2N3O2 — CID 3686318
4-(3,4-dichlorophenyl)-N-(2-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 3686318) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-N-(2-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(3,4-dichlorophenyl)-N-(2-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3686318 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-N-(2-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H19Cl2N3O2/c1-25-17-5-3-2-4-16(17)21-18(24)23-10-8-22(9-11-23)13-6-7-14(19)15(20)12-13/h2-7,12H,8-11H2,1H3,(H,21,24) |
| InChIKey | OJSLAOBJYPYLFR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |