C22H25Cl2N3O3 — CID 4995979
butyl 2-[[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 4995979) has the molecular formula C22H25Cl2N3O3 and a molecular weight of 450.37 g/mol. Its IUPAC name is butyl 2-[[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]amino]benzoate.
| Compound Name | butyl 2-[[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 4995979 |
| Molecular Formula | C22H25Cl2N3O3 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | butyl 2-[[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)N1CCN(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H25Cl2N3O3/c1-2-3-14-30-21(28)17-6-4-5-7-20(17)25-22(29)27-12-10-26(11-13-27)16-8-9-18(23)19(24)15-16/h4-9,15H,2-3,10-14H2,1H3,(H,25,29) |
| InChIKey | KVORIUMEDYZBJK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|