C22H26FN3O3 — CID 3854777
butyl 2-[[4-(4-fluorophenyl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 3854777) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is butyl 2-[[4-(4-fluorophenyl)piperazine-1-carbonyl]amino]benzoate.
| Compound Name | butyl 2-[[4-(4-fluorophenyl)piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3854777 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | butyl 2-[[4-(4-fluorophenyl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H26FN3O3/c1-2-3-16-29-21(27)19-6-4-5-7-20(19)24-22(28)26-14-12-25(13-15-26)18-10-8-17(23)9-11-18/h4-11H,2-3,12-16H2,1H3,(H,24,28) |
| InChIKey | IGEFKCSWWLGSBZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|