C21H29N3O5 — CID 3757261
butyl 2-[[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 3757261) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is butyl 2-[[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]amino]benzoate.
| Compound Name | butyl 2-[[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3757261 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | butyl 2-[[4-(oxolane-2-carbonyl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C21H29N3O5/c1-2-3-14-29-20(26)16-7-4-5-8-17(16)22-21(27)24-12-10-23(11-13-24)19(25)18-9-6-15-28-18/h4-5,7-8,18H,2-3,6,9-15H2,1H3,(H,22,27) |
| InChIKey | ZLCXMBGLKNBBMB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|