C20H25N3O4 — CID 108855909
butyl 2-[[(Z)-2-cyano-3-(oxolan-2-ylmethylamino)prop-2-enoyl]amino]benzoate (PubChem CID 108855909) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is butyl 2-[[(Z)-2-cyano-3-(oxolan-2-ylmethylamino)prop-2-enoyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-2-cyano-3-(oxolan-2-ylmethylamino)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108855909 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | butyl 2-[[(Z)-2-cyano-3-(oxolan-2-ylmethylamino)prop-2-enoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\NCC1CCCO1 |
| InChI | InChI=1S/C20H25N3O4/c1-2-3-10-27-20(25)17-8-4-5-9-18(17)23-19(24)15(12-21)13-22-14-16-7-6-11-26-16/h4-5,8-9,13,16,22H,2-3,6-7,10-11,14H2,1H3,(H,23,24)/b15-13- |
| InChIKey | IFENGKYXUOVMGG-SQFISAMPSA-N |
| XLogP | 2.76 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|