C21H29N5O3 — CID 108855976
butyl 2-[[(Z)-2-cyano-3-(2-piperazin-1-ylethylamino)prop-2-enoyl]amino]benzoate (PubChem CID 108855976) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is butyl 2-[[(Z)-2-cyano-3-(2-piperazin-1-ylethylamino)prop-2-enoyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-2-cyano-3-(2-piperazin-1-ylethylamino)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108855976 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | butyl 2-[[(Z)-2-cyano-3-(2-piperazin-1-ylethylamino)prop-2-enoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\NCCN1CCNCC1 |
| InChI | InChI=1S/C21H29N5O3/c1-2-3-14-29-21(28)18-6-4-5-7-19(18)25-20(27)17(15-22)16-24-10-13-26-11-8-23-9-12-26/h4-7,16,23-24H,2-3,8-14H2,1H3,(H,25,27)/b17-16- |
| InChIKey | QGJXBLLVEGQORN-MSUUIHNZSA-N |
| XLogP | 1.48 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|