C20H24N4O4 — CID 108826860
ethyl 2-[[(Z)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-2-enoyl]amino]benzoate (PubChem CID 108826860) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl 2-[[(Z)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 2-[[(Z)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108826860 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | ethyl 2-[[(Z)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\NCCCN1CCCC1=O |
| InChI | InChI=1S/C20H24N4O4/c1-2-28-20(27)16-7-3-4-8-17(16)23-19(26)15(13-21)14-22-10-6-12-24-11-5-9-18(24)25/h3-4,7-8,14,22H,2,5-6,9-12H2,1H3,(H,23,26)/b15-14- |
| InChIKey | NXCLJLOEQFOPDQ-PFONDFGASA-N |
| XLogP | 1.81 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|