C17H19BrN4O2 — CID 108815688
(Z)-N-(4-bromophenyl)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-2-enamide (PubChem CID 108815688) has the molecular formula C17H19BrN4O2 and a molecular weight of 391.27 g/mol. Its IUPAC name is (Z)-N-(4-bromophenyl)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-2-enamide.
| Compound Name | (Z)-N-(4-bromophenyl)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108815688 |
| Molecular Formula | C17H19BrN4O2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (Z)-N-(4-bromophenyl)-2-cyano-3-[3-(2-oxopyrrolidin-1-yl)propylamino]prop-2-enamide |
| SMILES | N#C/C(=C/NCCCN1CCCC1=O)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H19BrN4O2/c18-14-4-6-15(7-5-14)21-17(24)13(11-19)12-20-8-2-10-22-9-1-3-16(22)23/h4-7,12,20H,1-3,8-10H2,(H,21,24)/b13-12- |
| InChIKey | BRPGYKBHAWYPHE-SEYXRHQNSA-N |
| XLogP | 2.40 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|