C27H32N4O3 — CID 108856154
butyl 2-[[(Z)-3-[(1-benzylpiperidin-4-yl)amino]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 108856154) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is butyl 2-[[(Z)-3-[(1-benzylpiperidin-4-yl)amino]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-3-[(1-benzylpiperidin-4-yl)amino]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108856154 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | butyl 2-[[(Z)-3-[(1-benzylpiperidin-4-yl)amino]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N4O3/c1-2-3-17-34-27(33)24-11-7-8-12-25(24)30-26(32)22(18-28)19-29-23-13-15-31(16-14-23)20-21-9-5-4-6-10-21/h4-12,19,23,29H,2-3,13-17,20H2,1H3,(H,30,32)/b22-19- |
| InChIKey | PNDUGXZGFXYEGT-QOCHGBHMSA-N |
| XLogP | 4.24 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|