C22H22Cl2N4O — CID 108825678
(Z)-3-[(1-benzylpiperidin-4-yl)amino]-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide (PubChem CID 108825678) has the molecular formula C22H22Cl2N4O and a molecular weight of 429.35 g/mol. Its IUPAC name is (Z)-3-[(1-benzylpiperidin-4-yl)amino]-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[(1-benzylpiperidin-4-yl)amino]-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108825678 |
| Molecular Formula | C22H22Cl2N4O |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (Z)-3-[(1-benzylpiperidin-4-yl)amino]-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/NC1CCN(Cc2ccccc2)CC1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H22Cl2N4O/c23-18-6-7-20(24)21(12-18)27-22(29)17(13-25)14-26-19-8-10-28(11-9-19)15-16-4-2-1-3-5-16/h1-7,12,14,19,26H,8-11,15H2,(H,27,29)/b17-14- |
| InChIKey | RCDMYQNJIXSPAA-VKAVYKQESA-N |
| XLogP | 4.59 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|