C26H18Cl2N4O — CID 4506840
3-(1-benzyl-3-phenylpyrazol-4-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide (PubChem CID 4506840) has the molecular formula C26H18Cl2N4O and a molecular weight of 473.36 g/mol. Its IUPAC name is 3-(1-benzyl-3-phenylpyrazol-4-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide.
| Compound Name | 3-(1-benzyl-3-phenylpyrazol-4-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4506840 |
| Molecular Formula | C26H18Cl2N4O |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 3-(1-benzyl-3-phenylpyrazol-4-yl)-2-cyano-N-(2,5-dichlorophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1cn(Cc2ccccc2)nc1-c1ccccc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C26H18Cl2N4O/c27-22-11-12-23(28)24(14-22)30-26(33)20(15-29)13-21-17-32(16-18-7-3-1-4-8-18)31-25(21)19-9-5-2-6-10-19/h1-14,17H,16H2,(H,30,33) |
| InChIKey | IQBLWIHTVJVZLN-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|