C25H26N4O2 — CID 9187736
(E)-3-[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-N-butyl-2-cyanoprop-2-enamide (PubChem CID 9187736) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is (E)-3-[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-N-butyl-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-N-butyl-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 9187736 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (E)-3-[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-N-butyl-2-cyanoprop-2-enamide |
| SMILES | CCCCNC(=O)/C(C#N)=C/c1cn(Cc2ccccc2)nc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C25H26N4O2/c1-3-4-13-27-25(30)21(16-26)14-22-18-29(17-19-9-6-5-7-10-19)28-24(22)20-11-8-12-23(15-20)31-2/h5-12,14-15,18H,3-4,13,17H2,1-2H3,(H,27,30)/b21-14+ |
| InChIKey | GQSOABLPVNANIW-KGENOOAVSA-N |
| XLogP | 4.43 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|