C26H20N4O2 — CID 74274578
3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-2-(3-methoxybenzoyl)prop-2-enenitrile (PubChem CID 74274578) has the molecular formula C26H20N4O2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-2-(3-methoxybenzoyl)prop-2-enenitrile.
| Compound Name | 3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-2-(3-methoxybenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 74274578 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-(1-benzyl-3-pyridin-3-ylpyrazol-4-yl)-2-(3-methoxybenzoyl)prop-2-enenitrile |
| SMILES | COc1cccc(C(=O)C(C#N)=Cc2cn(Cc3ccccc3)nc2-c2cccnc2)c1 |
| InChI | InChI=1S/C26H20N4O2/c1-32-24-11-5-9-20(14-24)26(31)22(15-27)13-23-18-30(17-19-7-3-2-4-8-19)29-25(23)21-10-6-12-28-16-21/h2-14,16,18H,17H2,1H3 |
| InChIKey | FVUBSQKPYFAICS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|