C21H18N4O — CID 9252214
(E)-3-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]-2-cyanoprop-2-enamide (PubChem CID 9252214) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is (E)-3-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 9252214 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (E)-3-[1-benzyl-3-(4-methylphenyl)pyrazol-4-yl]-2-cyanoprop-2-enamide |
| SMILES | Cc1ccc(-c2nn(Cc3ccccc3)cc2/C=C(\C#N)C(N)=O)cc1 |
| InChI | InChI=1S/C21H18N4O/c1-15-7-9-17(10-8-15)20-19(11-18(12-22)21(23)26)14-25(24-20)13-16-5-3-2-4-6-16/h2-11,14H,13H2,1H3,(H2,23,26)/b18-11+ |
| InChIKey | AICKGCAIJGRBHX-WOJGMQOQSA-N |
| XLogP | 3.30 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|