C21H16N3O3- — CID 9340835
(E)-3-[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate (PubChem CID 9340835) has the molecular formula C21H16N3O3- and a molecular weight of 358.38 g/mol. Its IUPAC name is (E)-3-[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate.
| Compound Name | (E)-3-[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 9340835 |
| Molecular Formula | C21H16N3O3- |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (E)-3-[1-benzyl-3-(3-methoxyphenyl)pyrazol-4-yl]-2-cyanoprop-2-enoate |
| SMILES | COc1cccc(-c2nn(Cc3ccccc3)cc2/C=C(\C#N)C(=O)[O-])c1 |
| InChI | InChI=1S/C21H17N3O3/c1-27-19-9-5-8-16(11-19)20-18(10-17(12-22)21(25)26)14-24(23-20)13-15-6-3-2-4-7-15/h2-11,14H,13H2,1H3,(H,25,26)/p-1/b17-10+ |
| InChIKey | UTBJGEZHKXLIIE-LICLKQGHSA-M |
| XLogP | 2.26 |
| TPSA | 90.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|