C29H32N4O4 — CID 58258510
methyl 2-[[4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carbonyl]amino]benzoate (PubChem CID 58258510) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is methyl 2-[[4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 58258510 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | methyl 2-[[4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)N1CCN(c2ccc(NC(=O)CCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C29H32N4O4/c1-37-28(35)25-11-5-6-12-26(25)31-29(36)33-20-18-32(19-21-33)24-16-14-23(15-17-24)30-27(34)13-7-10-22-8-3-2-4-9-22/h2-6,8-9,11-12,14-17H,7,10,13,18-21H2,1H3,(H,30,34)(H,31,36) |
| InChIKey | WCFBGHHPDZDLBL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|