C22H28N4O3 — CID 109041344
methyl 2-[[3-[4-(4-methylpiperazin-1-yl)anilino]-3-oxopropyl]amino]benzoate (PubChem CID 109041344) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl 2-[[3-[4-(4-methylpiperazin-1-yl)anilino]-3-oxopropyl]amino]benzoate.
| Compound Name | methyl 2-[[3-[4-(4-methylpiperazin-1-yl)anilino]-3-oxopropyl]amino]benzoate |
|---|---|
| PubChem CID | 109041344 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | methyl 2-[[3-[4-(4-methylpiperazin-1-yl)anilino]-3-oxopropyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NCCC(=O)Nc1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H28N4O3/c1-25-13-15-26(16-14-25)18-9-7-17(8-10-18)24-21(27)11-12-23-20-6-4-3-5-19(20)22(28)29-2/h3-10,23H,11-16H2,1-2H3,(H,24,27) |
| InChIKey | HZAIJQNAVJQOET-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|