C20H23N3O3 — CID 55434513
methyl 2-[[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]benzoate (PubChem CID 55434513) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 2-[[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]benzoate.
| Compound Name | methyl 2-[[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 55434513 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | methyl 2-[[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NCC(=O)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-26-20(25)17-6-2-3-7-18(17)21-14-19(24)22-15-8-10-16(11-9-15)23-12-4-5-13-23/h2-3,6-11,21H,4-5,12-14H2,1H3,(H,22,24) |
| InChIKey | QARVIZZCLZLWSI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|