C34H41Cl2N5O2 — CID 58258562
N-[2,6-dichloro-4-(1-piperidin-1-ylethyl)phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide (PubChem CID 58258562) has the molecular formula C34H41Cl2N5O2 and a molecular weight of 622.64 g/mol. Its IUPAC name is N-[2,6-dichloro-4-(1-piperidin-1-ylethyl)phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[2,6-dichloro-4-(1-piperidin-1-ylethyl)phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58258562 |
| Molecular Formula | C34H41Cl2N5O2 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | N-[2,6-dichloro-4-(1-piperidin-1-ylethyl)phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
| SMILES | CC(c1cc(Cl)c(NC(=O)N2CCN(c3ccc(NC(=O)CCCc4ccccc4)cc3)CC2)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C34H41Cl2N5O2/c1-25(39-17-6-3-7-18-39)27-23-30(35)33(31(36)24-27)38-34(43)41-21-19-40(20-22-41)29-15-13-28(14-16-29)37-32(42)12-8-11-26-9-4-2-5-10-26/h2,4-5,9-10,13-16,23-25H,3,6-8,11-12,17-22H2,1H3,(H,37,42)(H,38,43) |
| InChIKey | FHQBQVUTAZFCSJ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|