C34H34Cl2N6O3 — CID 58258653
N-[2,6-dichloro-4-(pyridin-4-ylmethylcarbamoyl)phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide (PubChem CID 58258653) has the molecular formula C34H34Cl2N6O3 and a molecular weight of 645.59 g/mol. Its IUPAC name is N-[2,6-dichloro-4-(pyridin-4-ylmethylcarbamoyl)phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[2,6-dichloro-4-(pyridin-4-ylmethylcarbamoyl)phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58258653 |
| Molecular Formula | C34H34Cl2N6O3 |
| Molecular Weight | 645.59 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | N-[2,6-dichloro-4-(pyridin-4-ylmethylcarbamoyl)phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(CCCc1ccccc1)Nc1ccc(N2CCN(C(=O)Nc3c(Cl)cc(C(=O)NCc4ccncc4)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C34H34Cl2N6O3/c35-29-21-26(33(44)38-23-25-13-15-37-16-14-25)22-30(36)32(29)40-34(45)42-19-17-41(18-20-42)28-11-9-27(10-12-28)39-31(43)8-4-7-24-5-2-1-3-6-24/h1-3,5-6,9-16,21-22H,4,7-8,17-20,23H2,(H,38,44)(H,39,43)(H,40,45) |
| InChIKey | IWCNLKSEPKIQKL-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|