C30H33Cl2N5O4 — CID 143903791
N-[4-[2-[[2,6-dichloro-4-(morpholine-4-carbonyl)phenyl]carbamoylamino]ethylamino]phenyl]-4-phenylbutanamide (PubChem CID 143903791) has the molecular formula C30H33Cl2N5O4 and a molecular weight of 598.53 g/mol. Its IUPAC name is N-[4-[2-[[2,6-dichloro-4-(morpholine-4-carbonyl)phenyl]carbamoylamino]ethylamino]phenyl]-4-phenylbutanamide.
| Compound Name | N-[4-[2-[[2,6-dichloro-4-(morpholine-4-carbonyl)phenyl]carbamoylamino]ethylamino]phenyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 143903791 |
| Molecular Formula | C30H33Cl2N5O4 |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | N-[4-[2-[[2,6-dichloro-4-(morpholine-4-carbonyl)phenyl]carbamoylamino]ethylamino]phenyl]-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)Nc1ccc(NCCNC(=O)Nc2c(Cl)cc(C(=O)N3CCOCC3)cc2Cl)cc1 |
| InChI | InChI=1S/C30H33Cl2N5O4/c31-25-19-22(29(39)37-15-17-41-18-16-37)20-26(32)28(25)36-30(40)34-14-13-33-23-9-11-24(12-10-23)35-27(38)8-4-7-21-5-2-1-3-6-21/h1-3,5-6,9-12,19-20,33H,4,7-8,13-18H2,(H,35,38)(H2,34,36,40) |
| InChIKey | MTKATNOUYLJFOC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|