C32H37Cl2N5O4 — CID 58258573
N-[2,6-dichloro-4-[2-methoxyethyl(methyl)carbamoyl]phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide (PubChem CID 58258573) has the molecular formula C32H37Cl2N5O4 and a molecular weight of 626.59 g/mol. Its IUPAC name is N-[2,6-dichloro-4-[2-methoxyethyl(methyl)carbamoyl]phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[2,6-dichloro-4-[2-methoxyethyl(methyl)carbamoyl]phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58258573 |
| Molecular Formula | C32H37Cl2N5O4 |
| Molecular Weight | 626.59 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | N-[2,6-dichloro-4-[2-methoxyethyl(methyl)carbamoyl]phenyl]-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
| SMILES | COCCN(C)C(=O)c1cc(Cl)c(NC(=O)N2CCN(c3ccc(NC(=O)CCCc4ccccc4)cc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C32H37Cl2N5O4/c1-37(19-20-43-2)31(41)24-21-27(33)30(28(34)22-24)36-32(42)39-17-15-38(16-18-39)26-13-11-25(12-14-26)35-29(40)10-6-9-23-7-4-3-5-8-23/h3-5,7-8,11-14,21-22H,6,9-10,15-20H2,1-2H3,(H,35,40)(H,36,42) |
| InChIKey | DNASWMAKLUDUDY-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|