C28H31N5O5 — CID 58258311
N-(4-methoxy-2-nitrophenyl)-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide (PubChem CID 58258311) has the molecular formula C28H31N5O5 and a molecular weight of 517.59 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58258311 |
| Molecular Formula | C28H31N5O5 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3ccc(NC(=O)CCCc4ccccc4)cc3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H31N5O5/c1-38-24-14-15-25(26(20-24)33(36)37)30-28(35)32-18-16-31(17-19-32)23-12-10-22(11-13-23)29-27(34)9-5-8-21-6-3-2-4-7-21/h2-4,6-7,10-15,20H,5,8-9,16-19H2,1H3,(H,29,34)(H,30,35) |
| InChIKey | ZODKDVUTTXMDNS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|