C31H38N4O2 — CID 58258334
N-(2-tert-butylphenyl)-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide (PubChem CID 58258334) has the molecular formula C31H38N4O2 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58258334 |
| Molecular Formula | C31H38N4O2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | N-(2-tert-butylphenyl)-4-[4-(4-phenylbutanoylamino)phenyl]piperazine-1-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)N1CCN(c2ccc(NC(=O)CCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C31H38N4O2/c1-31(2,3)27-13-7-8-14-28(27)33-30(37)35-22-20-34(21-23-35)26-18-16-25(17-19-26)32-29(36)15-9-12-24-10-5-4-6-11-24/h4-8,10-11,13-14,16-19H,9,12,15,20-23H2,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | IGLRZVJDZIUVGH-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|