C29H33N3O4 — CID 58258535
N-[4-[4-[2-hydroxy-2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]-4-phenylbutanamide (PubChem CID 58258535) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[4-[4-[2-hydroxy-2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]-4-phenylbutanamide.
| Compound Name | N-[4-[4-[2-hydroxy-2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 58258535 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-[4-[4-[2-hydroxy-2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]-4-phenylbutanamide |
| SMILES | COc1ccc(C(O)C(=O)N2CCN(c3ccc(NC(=O)CCCc4ccccc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H33N3O4/c1-36-26-16-10-23(11-17-26)28(34)29(35)32-20-18-31(19-21-32)25-14-12-24(13-15-25)30-27(33)9-5-8-22-6-3-2-4-7-22/h2-4,6-7,10-17,28,34H,5,8-9,18-21H2,1H3,(H,30,33) |
| InChIKey | BIPOERHVWYRYIT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|