C23H27Cl2N5O3 — CID 58258395
N-[4-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]phenyl]-N',N'-dimethylbutanediamide (PubChem CID 58258395) has the molecular formula C23H27Cl2N5O3 and a molecular weight of 492.41 g/mol. Its IUPAC name is N-[4-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]phenyl]-N',N'-dimethylbutanediamide.
| Compound Name | N-[4-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]phenyl]-N',N'-dimethylbutanediamide |
|---|---|
| PubChem CID | 58258395 |
| Molecular Formula | C23H27Cl2N5O3 |
| Molecular Weight | 492.41 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | N-[4-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]phenyl]-N',N'-dimethylbutanediamide |
| SMILES | CN(C)C(=O)CCC(=O)Nc1ccc(N2CCN(C(=O)Nc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C23H27Cl2N5O3/c1-28(2)21(32)11-10-20(31)26-16-6-8-17(9-7-16)29-12-14-30(15-13-29)23(33)27-22-18(24)4-3-5-19(22)25/h3-9H,10-15H2,1-2H3,(H,26,31)(H,27,33) |
| InChIKey | UCONFYDTKZYDIS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|