C22H24Cl2N4O4 — CID 58258592
ethyl 3-[4-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]anilino]-3-oxopropanoate (PubChem CID 58258592) has the molecular formula C22H24Cl2N4O4 and a molecular weight of 479.36 g/mol. Its IUPAC name is ethyl 3-[4-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]anilino]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 58258592 |
| Molecular Formula | C22H24Cl2N4O4 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | ethyl 3-[4-[4-[(2,6-dichlorophenyl)carbamoyl]piperazin-1-yl]anilino]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)Nc1ccc(N2CCN(C(=O)Nc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C22H24Cl2N4O4/c1-2-32-20(30)14-19(29)25-15-6-8-16(9-7-15)27-10-12-28(13-11-27)22(31)26-21-17(23)4-3-5-18(21)24/h3-9H,2,10-14H2,1H3,(H,25,29)(H,26,31) |
| InChIKey | GPDGDYOCJGTIHL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|