C36H43Cl2N5O4 — CID 58258349
(4-methylphenyl)methyl 5-[4-[4-[[2,6-dichloro-4-(piperidin-1-ylmethyl)phenyl]carbamoyl]piperazin-1-yl]anilino]-5-oxopentanoate (PubChem CID 58258349) has the molecular formula C36H43Cl2N5O4 and a molecular weight of 680.68 g/mol. Its IUPAC name is (4-methylphenyl)methyl 5-[4-[4-[[2,6-dichloro-4-(piperidin-1-ylmethyl)phenyl]carbamoyl]piperazin-1-yl]anilino]-5-oxopentanoate.
| Compound Name | (4-methylphenyl)methyl 5-[4-[4-[[2,6-dichloro-4-(piperidin-1-ylmethyl)phenyl]carbamoyl]piperazin-1-yl]anilino]-5-oxopentanoate |
|---|---|
| PubChem CID | 58258349 |
| Molecular Formula | C36H43Cl2N5O4 |
| Molecular Weight | 680.68 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | (4-methylphenyl)methyl 5-[4-[4-[[2,6-dichloro-4-(piperidin-1-ylmethyl)phenyl]carbamoyl]piperazin-1-yl]anilino]-5-oxopentanoate |
| SMILES | Cc1ccc(COC(=O)CCCC(=O)Nc2ccc(N3CCN(C(=O)Nc4c(Cl)cc(CN5CCCCC5)cc4Cl)CC3)cc2)cc1 |
| InChI | InChI=1S/C36H43Cl2N5O4/c1-26-8-10-27(11-9-26)25-47-34(45)7-5-6-33(44)39-29-12-14-30(15-13-29)42-18-20-43(21-19-42)36(46)40-35-31(37)22-28(23-32(35)38)24-41-16-3-2-4-17-41/h8-15,22-23H,2-7,16-21,24-25H2,1H3,(H,39,44)(H,40,46) |
| InChIKey | SOGQEGVNHKDUPL-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.68 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|