C32H37ClN4O3 — CID 44548711
N-[4-[4-[2-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]acetyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 44548711) has the molecular formula C32H37ClN4O3 and a molecular weight of 561.13 g/mol. Its IUPAC name is N-[4-[4-[2-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]acetyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[4-[4-[2-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]acetyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 44548711 |
| Molecular Formula | C32H37ClN4O3 |
| Molecular Weight | 561.13 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | N-[4-[4-[2-[2-chloro-4-(pyrrolidin-1-ylmethyl)phenyl]acetyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(N3CCN(C(=O)Cc4ccc(CN5CCCC5)cc4Cl)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H37ClN4O3/c1-40-29-12-5-24(6-13-29)21-31(38)34-27-8-10-28(11-9-27)36-16-18-37(19-17-36)32(39)22-26-7-4-25(20-30(26)33)23-35-14-2-3-15-35/h4-13,20H,2-3,14-19,21-23H2,1H3,(H,34,38) |
| InChIKey | FEGINBCEBXRAPY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.13 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|