C26H26F2N4O3 — CID 42768647
1-(2,4-difluorophenyl)-3-[4-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]urea (PubChem CID 42768647) has the molecular formula C26H26F2N4O3 and a molecular weight of 480.52 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[4-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[4-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]urea |
|---|---|
| PubChem CID | 42768647 |
| Molecular Formula | C26H26F2N4O3 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[4-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]urea |
| SMILES | COc1ccc(CC(=O)N2CCN(c3ccc(NC(=O)Nc4ccc(F)cc4F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H26F2N4O3/c1-35-22-9-2-18(3-10-22)16-25(33)32-14-12-31(13-15-32)21-7-5-20(6-8-21)29-26(34)30-24-11-4-19(27)17-23(24)28/h2-11,17H,12-16H2,1H3,(H2,29,30,34) |
| InChIKey | LEIBJBJARAZRJC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|