C18H19F2N3O2 — CID 3258791
N-(2,5-difluorophenyl)-4-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 3258791) has the molecular formula C18H19F2N3O2 and a molecular weight of 347.37 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-4-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-(2,5-difluorophenyl)-4-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3258791 |
| Molecular Formula | C18H19F2N3O2 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-(2,5-difluorophenyl)-4-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3cc(F)ccc3F)CC2)cc1 |
| InChI | InChI=1S/C18H19F2N3O2/c1-25-15-5-3-14(4-6-15)22-8-10-23(11-9-22)18(24)21-17-12-13(19)2-7-16(17)20/h2-7,12H,8-11H2,1H3,(H,21,24) |
| InChIKey | ZKJNFMKSBGTELM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|