C12H15FN2O3 — CID 115687771
N-(2-fluoro-5-methoxyphenyl)morpholine-4-carboxamide (PubChem CID 115687771) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is N-(2-fluoro-5-methoxyphenyl)morpholine-4-carboxamide.
| Compound Name | N-(2-fluoro-5-methoxyphenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 115687771 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N-(2-fluoro-5-methoxyphenyl)morpholine-4-carboxamide |
| SMILES | COc1ccc(F)c(NC(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C12H15FN2O3/c1-17-9-2-3-10(13)11(8-9)14-12(16)15-4-6-18-7-5-15/h2-3,8H,4-7H2,1H3,(H,14,16) |
| InChIKey | JOHUUVLVYHVEPX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |