C13H17BrN2O2 — CID 79156264
N-(2-bromo-5-methoxyphenyl)piperidine-1-carboxamide (PubChem CID 79156264) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is N-(2-bromo-5-methoxyphenyl)piperidine-1-carboxamide.
| Compound Name | N-(2-bromo-5-methoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 79156264 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | N-(2-bromo-5-methoxyphenyl)piperidine-1-carboxamide |
| SMILES | COc1ccc(Br)c(NC(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-18-10-5-6-11(14)12(9-10)15-13(17)16-7-3-2-4-8-16/h5-6,9H,2-4,7-8H2,1H3,(H,15,17) |
| InChIKey | LCONLWGWANFUBW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |