C12H15BrN2O2 — CID 71982759
N-(4-bromo-3-methoxyphenyl)pyrrolidine-1-carboxamide (PubChem CID 71982759) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is N-(4-bromo-3-methoxyphenyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(4-bromo-3-methoxyphenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71982759 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-(4-bromo-3-methoxyphenyl)pyrrolidine-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCCC2)ccc1Br |
| InChI | InChI=1S/C12H15BrN2O2/c1-17-11-8-9(4-5-10(11)13)14-12(16)15-6-2-3-7-15/h4-5,8H,2-3,6-7H2,1H3,(H,14,16) |
| InChIKey | FNYQDFJCRJCELX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |