C19H22FN3O3 — CID 113114029
N-(2,4-dimethoxyphenyl)-4-(3-fluorophenyl)piperazine-1-carboxamide (PubChem CID 113114029) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(3-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(3-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113114029 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(3-fluorophenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3cccc(F)c3)CC2)c(OC)c1 |
| InChI | InChI=1S/C19H22FN3O3/c1-25-16-6-7-17(18(13-16)26-2)21-19(24)23-10-8-22(9-11-23)15-5-3-4-14(20)12-15/h3-7,12-13H,8-11H2,1-2H3,(H,21,24) |
| InChIKey | ORTOCEISGZPKGV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |