C22H29N3O3 — CID 113112429
N-(2,4-dimethoxyphenyl)-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide (PubChem CID 113112429) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113112429 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCN(c3c(C)cc(C)cc3C)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H29N3O3/c1-15-12-16(2)21(17(3)13-15)24-8-10-25(11-9-24)22(26)23-19-7-6-18(27-4)14-20(19)28-5/h6-7,12-14H,8-11H2,1-5H3,(H,23,26) |
| InChIKey | KHMUPQOLZQJJPE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |