C23H31N3O3 — CID 113110280
N-[2-(4-methoxyphenoxy)ethyl]-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide (PubChem CID 113110280) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113110280 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-4-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)N2CCN(c3c(C)cc(C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O3/c1-17-15-18(2)22(19(3)16-17)25-10-12-26(13-11-25)23(27)24-9-14-29-21-7-5-20(28-4)6-8-21/h5-8,15-16H,9-14H2,1-4H3,(H,24,27) |
| InChIKey | IDHUKIPTOMHMHX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|