C20H25N3O4 — CID 113113504
4-(2,5-dimethoxyphenyl)-N-(2-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 113113504) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-N-(2-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-(2,5-dimethoxyphenyl)-N-(2-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113113504 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-N-(2-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(OC)c(N2CCN(C(=O)Nc3ccccc3OC)CC2)c1 |
| InChI | InChI=1S/C20H25N3O4/c1-25-15-8-9-19(27-3)17(14-15)22-10-12-23(13-11-22)20(24)21-16-6-4-5-7-18(16)26-2/h4-9,14H,10-13H2,1-3H3,(H,21,24) |
| InChIKey | AWHZXRSCDOAOOP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |