C15H19F3N2O3 — CID 71992851
N-(2,4-dimethoxyphenyl)-4-(trifluoromethyl)piperidine-1-carboxamide (PubChem CID 71992851) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(trifluoromethyl)piperidine-1-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(trifluoromethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71992851 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(trifluoromethyl)piperidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC(C(F)(F)F)CC2)c(OC)c1 |
| InChI | InChI=1S/C15H19F3N2O3/c1-22-11-3-4-12(13(9-11)23-2)19-14(21)20-7-5-10(6-8-20)15(16,17)18/h3-4,9-10H,5-8H2,1-2H3,(H,19,21) |
| InChIKey | HMLQPJFNHGIAQP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |