C22H23F3N2O4 — CID 25297991
(3R)-N-(2,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)benzoyl]piperidine-1-carboxamide (PubChem CID 25297991) has the molecular formula C22H23F3N2O4 and a molecular weight of 436.43 g/mol. Its IUPAC name is (3R)-N-(2,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)benzoyl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-(2,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)benzoyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 25297991 |
| Molecular Formula | C22H23F3N2O4 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (3R)-N-(2,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)benzoyl]piperidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC[C@@H](C(=O)c3cccc(C(F)(F)F)c3)C2)c(OC)c1 |
| InChI | InChI=1S/C22H23F3N2O4/c1-30-17-8-9-18(19(12-17)31-2)26-21(29)27-10-4-6-15(13-27)20(28)14-5-3-7-16(11-14)22(23,24)25/h3,5,7-9,11-12,15H,4,6,10,13H2,1-2H3,(H,26,29)/t15-/m1/s1 |
| InChIKey | WFXBAFUSILJGIW-OAHLLOKOSA-N |
| XLogP | 4.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |