C21H23ClN2O3 — CID 42395615
(3R)-3-(3-chlorobenzoyl)-N-(2-methoxy-5-methylphenyl)piperidine-1-carboxamide (PubChem CID 42395615) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is (3R)-3-(3-chlorobenzoyl)-N-(2-methoxy-5-methylphenyl)piperidine-1-carboxamide.
| Compound Name | (3R)-3-(3-chlorobenzoyl)-N-(2-methoxy-5-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 42395615 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (3R)-3-(3-chlorobenzoyl)-N-(2-methoxy-5-methylphenyl)piperidine-1-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)N1CCC[C@@H](C(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-14-8-9-19(27-2)18(11-14)23-21(26)24-10-4-6-16(13-24)20(25)15-5-3-7-17(22)12-15/h3,5,7-9,11-12,16H,4,6,10,13H2,1-2H3,(H,23,26)/t16-/m1/s1 |
| InChIKey | JEQAKKKLCPYPIS-MRXNPFEDSA-N |
| XLogP | 4.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |