C13H16BClNO2 — CID 70315573
CID 70315573 (PubChem CID 70315573) has the molecular formula C13H16BClNO2 and a molecular weight of 264.54 g/mol.
| Compound Name | CID 70315573 |
|---|---|
| PubChem CID | 70315573 |
| Molecular Formula | C13H16BClNO2 |
| Molecular Weight | 264.54 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | — |
| SMILES | CO[B]N1CCC[C@@H](C(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C13H16BClNO2/c1-18-14-16-7-3-5-11(9-16)13(17)10-4-2-6-12(15)8-10/h2,4,6,8,11H,3,5,7,9H2,1H3/t11-/m1/s1 |
| InChIKey | BFPMYUSACDJESZ-LLVKDONJSA-N |
| XLogP | 2.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|