C14H19NO2 — CID 82389965
(3-methoxyphenyl)-(1-methylpiperidin-3-yl)methanone (PubChem CID 82389965) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (3-methoxyphenyl)-(1-methylpiperidin-3-yl)methanone.
| Compound Name | (3-methoxyphenyl)-(1-methylpiperidin-3-yl)methanone |
|---|---|
| PubChem CID | 82389965 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3-methoxyphenyl)-(1-methylpiperidin-3-yl)methanone |
| SMILES | COc1cccc(C(=O)C2CCCN(C)C2)c1 |
| InChI | InChI=1S/C14H19NO2/c1-15-8-4-6-12(10-15)14(16)11-5-3-7-13(9-11)17-2/h3,5,7,9,12H,4,6,8,10H2,1-2H3 |
| InChIKey | APBTWTLUDVKHBE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |