C19H20N2O4 — CID 42151891
(3-methoxyphenyl)-[(3S)-1-(1-oxidopyridin-1-ium-4-carbonyl)piperidin-3-yl]methanone (PubChem CID 42151891) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (3-methoxyphenyl)-[(3S)-1-(1-oxidopyridin-1-ium-4-carbonyl)piperidin-3-yl]methanone.
| Compound Name | (3-methoxyphenyl)-[(3S)-1-(1-oxidopyridin-1-ium-4-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 42151891 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (3-methoxyphenyl)-[(3S)-1-(1-oxidopyridin-1-ium-4-carbonyl)piperidin-3-yl]methanone |
| SMILES | COc1cccc(C(=O)[C@H]2CCCN(C(=O)c3cc[n+]([O-])cc3)C2)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-25-17-6-2-4-15(12-17)18(22)16-5-3-9-20(13-16)19(23)14-7-10-21(24)11-8-14/h2,4,6-8,10-12,16H,3,5,9,13H2,1H3/t16-/m0/s1 |
| InChIKey | KBIYCHVJCKKGEQ-INIZCTEOSA-N |
| XLogP | 2.06 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|